logo
Home  > Chloroacetyl-l-tyrosine

AA18699

1145-56-8 | Chloroacetyl-l-tyrosine

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $129.00 $90.00 -   +
5g 95% in stock $386.00 $270.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA18699
Chemical Name: Chloroacetyl-l-tyrosine
CAS Number: 1145-56-8
Molecular Formula: C11H12ClNO4
Molecular Weight: 257.6703
MDL Number: MFCD00002390
SMILES: ClCC(=O)N[C@H](C(=O)O)Cc1ccc(cc1)O

 

Upstream Synthesis Route 
  • N-Chloroacetyl-L-tyrosine is a versatile compound widely used in chemical synthesis as a key intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. With its unique structure and reactivity, this compound plays a crucial role in various organic transformations, facilitating the introduction of functional groups such as chloroacetyl and amino acids into complex molecular structures. Its application in peptide and drug synthesis is particularly notable, where it serves as a valuable building block for the modification and synthesis of novel bioactive compounds. Additionally, N-Chloroacetyl-L-tyrosine is utilized in the development of advanced materials and biochemical research, showcasing its significance in the realm of modern chemical science.
FEATURED PRODUCTS