1145678-75-6 | L-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-2-methyl-

Availability
Typically In Stock

Description

• Catalog Number: BD65920
• Chemical Name: L-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-2-methyl-
• CAS Number: 1145678-75-6
• Molecular Formula: C25H23NO5
• Molecular Weight: 417.4538
• SMILES: O=C(N[C@H](C(=O)O)Cc1ccc(cc1C)O)OCC1c2ccccc2-c2c1cccc2

Upstream Synthesis Route

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-2-methyl-L-tyrosine, commonly known as $name$, serves as a versatile building block in chemical synthesis. This compound plays a crucial role in peptide synthesis and drug development due to its unique chemical properties. By incorporating $name$ into synthetic pathways, chemists can efficiently introduce the specific functional groups and stereochemistry required for the production of complex organic molecules. Additionally, the presence of the fluorenyl protecting group in $name$ enhances the stability of the molecule during various chemical reactions, making it an essential tool in organic synthesis strategies.