AE19569
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $249.00 | $175.00 | - + | |
1g | 96% | in stock | $556.00 | $390.00 | - + | |
5g | 96% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE19569 |
Chemical Name: | Methyl N-BOC-(2R,4R)-4-Aminopyrrolidine-2-carboxylate |
CAS Number: | 1146160-08-8 |
Molecular Formula: | C11H20N2O4 |
Molecular Weight: | 244.2875 |
MDL Number: | MFCD00214089 |
SMILES: | CC(C)(C)OC(=O)N1CC(CC1C(=O)OC)N |
Complexity: | 311 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 0.3 |
Methyl (2R,4R)-1-Boc-4-aminopyrrolidine-2-carboxylate is a versatile compound commonly utilized in chemical synthesis as a key building block. This compound plays a crucial role in organic chemistry as a precursor for the preparation of various pharmaceuticals, agrochemicals, and functional materials. Its unique chemical structure allows for the selective modification of functional groups, enabling the synthesis of complex molecules with high stereochemical purity. By incorporating Methyl (2R,4R)-1-Boc-4-aminopyrrolidine-2-carboxylate into synthetic pathways, chemists can efficiently access a wide range of structurally diverse compounds with potential applications in drug discovery and material science.