AA19275
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $21.00 | $15.00 | - + | |
250mg | 95% | in stock | $30.00 | $21.00 | - + | |
1g | 95% | in stock | $82.00 | $58.00 | - + | |
5g | 95% | in stock | $289.00 | $203.00 | - + | |
25g | 95% | in stock | $1,356.00 | $949.00 | - + | |
50g | 95% | in stock | $2,231.00 | $1,562.00 | - + | |
100g | 95% | in stock | $3,587.00 | $2,511.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19275 |
Chemical Name: | (2S,4R)-tert-Butyl 4-hydroxy-2-methylpyrrolidine-1-carboxylate |
CAS Number: | 114676-61-8 |
Molecular Formula: | C10H19NO3 |
Molecular Weight: | 201.2628 |
MDL Number: | MFCD11111254 |
SMILES: | C[C@H]1C[C@H](CN1C(=O)OC(C)(C)C)O |
Complexity: | 222 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.1 |
The compound (2S,4R)-tert-Butyl 4-hydroxy-2-methylpyrrolidine-1-carboxylate, also known as $name$, serves as a valuable chiral building block in chemical synthesis. Its unique stereochemistry and functional groups make it particularly useful for the asymmetric construction of complex organic molecules. This compound can be employed as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals where chiral purity is crucial for their activity and properties. By utilizing (2S,4R)-tert-Butyl 4-hydroxy-2-methylpyrrolidine-1-carboxylate as a starting material or intermediate, chemists can access enantiomerically pure compounds that exhibit specific biological activities or have desirable physicochemical characteristics.