AA19359
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 97% | in stock | $23.00 | $16.00 | - + | |
250mg | 97% | in stock | $83.00 | $58.00 | - + | |
1g | 97% | in stock | $202.00 | $142.00 | - + | |
5g | 97% | in stock | $612.00 | $429.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19359 |
Chemical Name: | 6,6'-Dibromo-1,1'-bis(2-ethylhexyl)-[3,3'-biindolinylidene]-2,2'-dione |
CAS Number: | 1147124-23-9 |
Molecular Formula: | C32H40Br2N2O2 |
Molecular Weight: | 644.4802 |
MDL Number: | MFCD28125575 |
SMILES: | CCCCC(CN1C(=O)C(=C2c3ccc(cc3N(C2=O)CC(CCCC)CC)Br)c2c1cc(Br)cc2)CC |
6,6'-Dibromo-1,1'-bis(2-ethylhexyl)-[3,3'-biindolinylidene]-2,2'-dione is a versatile compound commonly used in chemical synthesis due to its unique properties. This compound is especially valuable in the field of organic synthesis as a key component in the development of new materials, functional molecules, and pharmaceutical compounds. Its high reactivity and stability make it ideal for the construction of complex molecular structures through various synthetic routes. In particular, 6,6'-Dibromo-1,1'-bis(2-ethylhexyl)-[3,3'-biindolinylidene]-2,2'-dione is utilized in the formation of novel polymers, organic semiconductors, and fluorescent dyes. Its ability to undergo diverse chemical reactions, such as cross-coupling reactions and cycloaddition reactions, further enhances its utility in organic synthesis processes. Additionally, its presence in the synthesis of biologically active compounds highlights its significance in medicinal chemistry research. By serving as a crucial building block in the creation of advanced organic compounds, 6,6'-Dibromo-1,1'-bis(2-ethylhexyl)-[3,3'-biindolinylidene]-2,2'-dione plays a pivotal role in expanding the horizons of chemical synthesis applications.