AE25167
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $137.00 | $96.00 | - + | |
250mg | 98% | in stock | $241.00 | $169.00 | - + | |
1g | 98% | in stock | $471.00 | $330.00 | - + | |
5g | 98% | in stock | $1,535.00 | $1,074.00 | - + | |
10g | 98% | in stock | $2,499.00 | $1,749.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE25167 |
Chemical Name: | 4-Fluoro-3,5-dimethylphenylboronic acid, pinacol ester |
CAS Number: | 1147894-98-1 |
Molecular Formula: | C14H20BFO2 |
Molecular Weight: | 250.1168 |
MDL Number: | MFCD12405367 |
SMILES: | CC1(C)OB(OC1(C)C)c1cc(C)c(c(c1)C)F |
Complexity: | 291 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 1 |
4-Fluoro-3,5-diMethylphenylboronic acid, pinacol ester is a valuable reagent frequently utilized in chemical synthesis as a versatile building block. In organic chemistry, this compound serves as a crucial tool for the construction of complex molecules through Suzuki-Miyaura cross-coupling reactions. By facilitating the formation of carbon-carbon bonds, it enables the preparation of various biaryl compounds, heterocycles, pharmaceutical intermediates, and agrochemicals. This compound's ability to participate in diverse transformations makes it a sought-after component in the toolbox of synthetic chemists aiming to access novel compounds with tailored properties.