logo
Home  > Chemistry  > Catalysis Chemistry  > Nitrogen-Donor Ligands  > 2,2':6',2''-Terpyridine

AA19543

1148-79-4 | 2,2':6',2''-Terpyridine

Packsize Purity Availability Price Discounted Price    Quantity
100mg 98% in stock $27.00 $19.00 -   +
250mg 98% in stock $34.00 $24.00 -   +
1g 98% in stock $84.00 $59.00 -   +
5g 98% in stock $102.00 $72.00 -   +
10g 98% in stock $177.00 $124.00 -   +
25g 98% in stock $342.00 $240.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA19543
Chemical Name: 2,2':6',2''-Terpyridine
CAS Number: 1148-79-4
Molecular Formula: C15H11N3
Molecular Weight: 233.2679
MDL Number: MFCD00006213
SMILES: c1ccc(nc1)c1cccc(n1)c1ccccn1

 

Computed Properties
Complexity: 232  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 18  
Hydrogen Bond Acceptor Count: 3  
Rotatable Bond Count: 2  
XLogP3: 2.4  

 

 

Upstream Synthesis Route
  • 2,2':6',2''-Terpyridine, commonly used in chemical synthesis, serves as a versatile ligand in coordination chemistry due to its unique tridentate chelating properties. This compound forms stable complexes with various metal ions, notably transition metals such as ruthenium, iridium, and platinum. In organic synthesis, 2,2':6',2''-Terpyridine plays a crucial role in promoting selective reactions and catalysis. Its ability to modulate the coordination environment of metal centers enables the precise control of reaction pathways and the formation of desired products. This ligand is particularly valuable in the design and fabrication of coordination polymers, supramolecular assemblies, and molecular devices, showcasing its significance in advancing materials science and catalysis.
FEATURED PRODUCTS