AA19543
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $27.00 | $19.00 | - + | |
250mg | 98% | in stock | $34.00 | $24.00 | - + | |
1g | 98% | in stock | $84.00 | $59.00 | - + | |
5g | 98% | in stock | $102.00 | $72.00 | - + | |
10g | 98% | in stock | $177.00 | $124.00 | - + | |
25g | 98% | in stock | $342.00 | $240.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19543 |
Chemical Name: | 2,2':6',2''-Terpyridine |
CAS Number: | 1148-79-4 |
Molecular Formula: | C15H11N3 |
Molecular Weight: | 233.2679 |
MDL Number: | MFCD00006213 |
SMILES: | c1ccc(nc1)c1cccc(n1)c1ccccn1 |
Complexity: | 232 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.4 |
2,2':6',2''-Terpyridine, commonly used in chemical synthesis, serves as a versatile ligand in coordination chemistry due to its unique tridentate chelating properties. This compound forms stable complexes with various metal ions, notably transition metals such as ruthenium, iridium, and platinum. In organic synthesis, 2,2':6',2''-Terpyridine plays a crucial role in promoting selective reactions and catalysis. Its ability to modulate the coordination environment of metal centers enables the precise control of reaction pathways and the formation of desired products. This ligand is particularly valuable in the design and fabrication of coordination polymers, supramolecular assemblies, and molecular devices, showcasing its significance in advancing materials science and catalysis.