114873-46-0 | 10-(2-Hydroxyethyl)-1,4,7,10-tetraazacyclododecane-1,4,7-triacetic acid

Availability
Typically In Stock

Description

• Catalog Number: BL17892
• Chemical Name: 10-(2-Hydroxyethyl)-1,4,7,10-tetraazacyclododecane-1,4,7-triacetic acid
• CAS Number: 114873-46-0
• Molecular Formula: C16H30N4O7
• Molecular Weight: 390.4320
• SMILES: OCCN1CCN(CCN(CCN(CC1)CC(=O)O)CC(=O)O)CC(=O)O

Upstream Synthesis Route

10-(2-Hydroxyethyl)-1,4,7,10-tetraazacyclododecane-1,4,7-triacetic acid, also known as $name$, is a versatile compound widely used in chemical synthesis processes. This unique acid derivative plays a crucial role as a chelating agent in various chemical reactions and applications. In chemical synthesis, $name$ is often utilized for its exceptional ability to form stable complexes with metal ions, particularly transition metals such as copper, zinc, and nickel. These complexes are essential in facilitating diverse catalytic reactions, including cross-coupling reactions, oxidation reactions, and asymmetric synthesis processes.Moreover, the presence of the hydroxyethyl group in the molecular structure of $name$ enhances its solubility in aqueous solutions, making it an ideal candidate for coordination chemistry in aqueous environments. This property is particularly advantageous in bioinorganic chemistry studies and pharmaceutical research, where water-soluble chelating agents are necessary for the preparation of metal-based drugs and imaging agents.Additionally, the triacetic acid functionality in $name$ provides multiple coordination sites for metal ion binding, allowing for the formation of stable and well-defined metal complexes. This feature is exploited in the design and development of novel coordination compounds for various industrial applications, such as environmental remediation, material science, and catalysis.Overall, the application of 10-(2-Hydroxyethyl)-1,4,7,10-tetraazacyclododecane-1,4,7-triacetic acid in chemical synthesis showcases its significance as a valuable tool for complex formation, metal coordination, and catalytic reactions, making it a versatile and indispensable component in modern chemistry research and innovation.