AI09699
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 98% | in stock | $151.00 | $106.00 | - + | |
100mg | 98% | in stock | $446.00 | $312.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI09699 |
Chemical Name: | 7,10-O-ditroc docetaxel |
CAS Number: | 114915-14-9 |
Molecular Formula: | C49H55Cl6NO18 |
Molecular Weight: | 1158.6749 |
MDL Number: | MFCD09839023 |
SMILES: | O=C(O[C@H]1C(=O)[C@]2(C)[C@@H](OC(=O)OCC(Cl)(Cl)Cl)C[C@@H]3[C@]([C@@H]2[C@@H]([C@]2(C(C1=C(C)[C@@H](OC(=O)[C@@H]([C@H](c1ccccc1)NC(=O)OC(C)(C)C)O)C2)(C)C)O)OC(=O)c1ccccc1)(CO3)OC(=O)C)OCC(Cl)(Cl)Cl |
Complexity: | 2180 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 11 |
Heavy Atom Count: | 74 |
Hydrogen Bond Acceptor Count: | 18 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 21 |
XLogP3: | 7.3 |
The compound 7,10-O-ditroc docetaxel is a valuable intermediate in chemical synthesis, particularly in the context of medicinal chemistry and drug development. With its carefully designed structural modifications, this derivative serves as a crucial building block for the synthesis of novel pharmaceutical compounds with enhanced biological activity and improved pharmacokinetic properties. By strategically incorporating this intermediate into synthetic pathways, chemists can access a diverse array of potential drug candidates with optimized performance profiles for targeted therapeutic applications.