114970-20-6 | SCH 38519

Packsize	Purity	Availability	Price	Discounted Price
2.5mg	95%	in stock	$1,649.00	$1,154.00

Description

• Catalog Number: AE25391
• Chemical Name: SCH 38519
• CAS Number: 114970-20-6
• Molecular Formula: C24H25NO8
• Molecular Weight: 455.4572
• MDL Number: MFCD00185576
• SMILES: O=C1C[C@@H]2[C@H](O1)C1=C([C@H](O2)C)C(=O)c2c(C1=O)c1[C@H]3C[C@H]([C@@H]([C@@](c1cc2O)(O3)C)O)N(C)C

Upstream Synthesis Route

Antibiotic Sch 38519 is a valuable tool in chemical synthesis due to its unique properties and versatile applications. This antibiotic, derived from natural sources, has shown significant efficacy in combating bacteria by interfering with their cell wall synthesis. Beyond its antibiotic properties, Sch 38519 is widely utilized in organic chemistry as a chiral building block for the synthesis of complex molecules.Due to its specific structural characteristics, Antibiotic Sch 38519 serves as a valuable starting material for the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals. Its chiral nature allows chemists to introduce specific stereochemistry into target molecules, essential for the development of new drugs and materials. Its ability to selectively inhibit the growth of certain bacterial strains also makes it a crucial component in the synthesis of antibacterial agents with enhanced efficacy.In the realm of chemical synthesis, Antibiotic Sch 38519 plays a crucial role in the creation of asymmetric synthesis pathways, enabling the production of enantiomerically pure compounds. Its broad substrate scope and high chemical reactivity make it an ideal candidate for use in complex synthetic sequences, ultimately leading to the efficient production of various bioactive molecules and key intermediates.Overall, Antibiotic Sch 38519's application in chemical synthesis exemplifies its importance as a versatile and powerful tool for researchers and chemists in the development of novel compounds with potential applications across diverse sectors.