AX32217
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 3 weeks | $487.00 | $341.00 | - + | ||
2.5g | 3 weeks | $2,563.00 | $1,794.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX32217 |
Chemical Name: | AmbenoniumDichloride |
CAS Number: | 115-79-7 |
Molecular Formula: | C28H42Cl4N4O2 |
Molecular Weight: | 608.4707 |
MDL Number: | MFCD00153762 |
SMILES: | CC[N+](Cc1ccccc1Cl)(CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)CC.[Cl-].[Cl-] |
Ambenonium chloride is a pharmaceutical compound that is utilized in chemical synthesis as a cholinesterase inhibitor. It is specifically designed to inhibit the enzyme acetylcholinesterase, thereby increasing the levels of acetylcholine in the synaptic cleft. This mechanism of action makes Ambenonium chloride valuable in various chemical synthesis processes, particularly in the development of medications for conditions such as myasthenia gravis.In chemical synthesis, Ambenonium chloride can serve as a key building block in the creation of novel pharmaceuticals that target the cholinergic system. By modulating the neurotransmitter acetylcholine, this compound can play a crucial role in the design and production of drugs that affect neuromuscular function and cognitive processes. Additionally, Ambenonium chloride's specific inhibition of acetylcholinesterase makes it a valuable tool in biochemical studies and drug discovery efforts.Overall, the application of Ambenonium chloride in chemical synthesis underscores its significance in the pharmaceutical industry and research laboratories, where its unique properties are harnessed to advance our understanding of neurological disorders and develop innovative treatments.