AA20001
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $28.00 | $19.00 | - + | |
5g | 97% | in stock | $77.00 | $54.00 | - + | |
25g | 97% | in stock | $231.00 | $162.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA20001 |
Chemical Name: | 1-(Chloro-1-pyrrolidinylmethylene)pyrrolidinium tetrafluoroborate |
CAS Number: | 115007-14-2 |
Molecular Formula: | C9H16BClF4N2 |
Molecular Weight: | 274.4944 |
MDL Number: | MFCD00191334 |
SMILES: | F[B-](F)(F)F.ClC(=[N+]1CCCC1)N1CCCC1 |
Complexity: | 185 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 1 |
1-(Chloro(pyrrolidin-1-yl)methylene)pyrrolidin-1-ium tetrafluoroborate is a versatile chemical compound commonly used in chemical synthesis as a reagent for various organic transformations. Its unique structure confers it the ability to act as a powerful electrophile, making it effective in reactions involving nucleophilic substitution and addition. This compound has found applications in the synthesis of heterocyclic compounds, pharmaceutical intermediates, and specialty chemicals due to its ability to facilitate selective and efficient transformations. Additionally, 1-(Chloro(pyrrolidin-1-yl)methylene)pyrrolidin-1-ium tetrafluoroborate is known for its stability and compatibility with a wide range of reaction conditions, making it a valuable tool in modern organic synthesis strategies.