AA20981
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97% | in stock | $11.00 | $8.00 | - + | |
10mg | 97% | in stock | $17.00 | $12.00 | - + | |
25mg | 97% | in stock | $23.00 | $17.00 | - + | |
100mg | 97% | in stock | $33.00 | $23.00 | - + | |
250mg | 97% | in stock | $54.00 | $38.00 | - + | |
1g | 97% | in stock | $158.00 | $111.00 | - + | |
5g | 97% | in stock | $544.00 | $381.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA20981 |
Chemical Name: | D-Luciferin potassium salt |
CAS Number: | 115144-35-9 |
Molecular Formula: | C11H7KN2O3S2 |
Molecular Weight: | 318.4132 |
MDL Number: | MFCD00044928 |
SMILES: | [O-]C(=O)[C@H]1CSC(=N1)c1nc2c(s1)cc(cc2)O.[K+] |
Complexity: | 396 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
The Journal of biological chemistry 19760125