AA20986
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $11.00 | $8.00 | - + | |
250mg | 97% | in stock | $26.00 | $18.00 | - + | |
1g | 97% | in stock | $47.00 | $33.00 | - + | |
5g | 97% | in stock | $230.00 | $161.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA20986 |
Chemical Name: | 2-(2-Chloro-3-methoxyphenyl)-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane |
CAS Number: | 1151564-03-2 |
Molecular Formula: | C13H18BClO3 |
Molecular Weight: | 268.5442 |
MDL Number: | MFCD07782041 |
SMILES: | COc1cccc(c1Cl)B1OC(C(O1)(C)C)(C)C |
Complexity: | 293 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
2-(2-Chloro-3-methoxyphenyl)-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane is a versatile chemical reagent commonly used in organic synthesis. This compound plays a crucial role in the formation of carbon-carbon bonds through Suzuki-Miyaura cross-coupling reactions. By acting as a boron source, this dioxaborolane facilitates the coupling of aryl and vinyl halides with various boronic acids or esters, leading to the creation of complex organic molecules. Its unique structure and reactivity make it a valuable tool for the construction of biaryl compounds, natural product synthesis, and pharmaceutical research.