logo
Home  > Thymidine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-α-methoxy-

AA21023

115173-73-4 | Thymidine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-α-methoxy-

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% 2 weeks $77.00 $54.00 -   +
1g 95% 2 weeks $158.00 $110.00 -   +
5g 95% 2 weeks $729.00 $510.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA21023
Chemical Name: Thymidine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-α-methoxy-
CAS Number: 115173-73-4
Molecular Formula: C32H34N2O8
Molecular Weight: 574.621
MDL Number: MFCD01631071
SMILES: COCc1cn([C@H]2C[C@@H]([C@H](O2)COC(c2ccc(cc2)OC)(c2ccc(cc2)OC)c2ccccc2)O)c(=O)[nH]c1=O

 

Upstream Synthesis Route
  • Thymidine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-α-methoxy-, is a compound commonly utilized in chemical synthesis procedures. This compound serves as a valuable building block in the creation of various molecules due to its unique structural characteristics and reactivity.In chemical synthesis, Thymidine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-α-methoxy-, can be employed as a key intermediate to introduce specific functional groups or moieties into target molecules. Its methoxyphenyl groups and methoxy moiety can serve as reactive sites for further derivatization, allowing chemists to tailor the compound to meet the desired properties or functions needed for a particular application.Furthermore, the presence of the thymidine backbone in this compound can provide additional stability and structural integrity to the synthesized molecules. This can be crucial in the development of pharmaceuticals, agrochemicals, materials science, and other fields where precise control over molecular structure is essential for optimal performance.Overall, Thymidine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-α-methoxy-, is a versatile and reliable tool in the hands of synthetic chemists, enabling the creation of complex and functional compounds with tailored properties for a wide range of applications.
FEATURED PRODUCTS