AA21618
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $5.00 | - + | |
5g | 98% | in stock | $9.00 | $6.00 | - + | |
10g | 98% | in stock | $12.00 | $8.00 | - + | |
25g | 98% | in stock | $24.00 | $17.00 | - + | |
100g | 98% | in stock | $66.00 | $46.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA21618 |
Chemical Name: | 3-Fluoro-4-(trifluoromethyl)benzoic acid |
CAS Number: | 115754-21-7 |
Molecular Formula: | C8H4F4O2 |
Molecular Weight: | 208.1098 |
MDL Number: | MFCD00236279 |
SMILES: | OC(=O)c1ccc(c(c1)F)C(F)(F)F |
Complexity: | 226 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.4 |
The 3-Fluoro-4-(Trifluoromethyl)Benzoic Acid is a highly versatile compound used in various chemical synthesis processes. Its unique molecular structure makes it a valuable building block in the development of pharmaceuticals, agricultural chemicals, and advanced materials.In chemical synthesis, this compound serves as a key intermediate for the production of specialized compounds with enhanced properties. It can be employed in the creation of novel drug molecules by modification of its functional groups, leading to improved biological activity and pharmacokinetic profiles. Additionally, its trifluoromethyl moiety can impart valuable properties such as increased lipophilicity and metabolic stability to the final products.Furthermore, the 3-Fluoro-4-(Trifluoromethyl)Benzoic Acid is utilized in the synthesis of agrochemicals to enhance plant protection and crop productivity. Its ability to modify the activity of pesticides and herbicides makes it a crucial component in the development of environmentally friendly and effective agricultural solutions.Moreover, this compound finds application in the synthesis of advanced materials, such as polymers and specialty chemicals, where its unique fluorine-containing groups can introduce desirable characteristics like thermal stability, chemical resistance, and optical properties. Its versatility in molecular design offers researchers and chemists a wide range of possibilities for creating innovative and high-performance materials for various industries.