AE12812
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 2 weeks | $427.00 | $299.00 | - + | ||
25g | 2 weeks | $642.00 | $449.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE12812 |
Chemical Name: | Hidiosmin |
CAS Number: | 115960-14-0 |
Molecular Formula: | C30H36O16 |
Molecular Weight: | 652.5972 |
MDL Number: | MFCD01744563 |
SMILES: | OCCOc1cc(OC2OC(COC3OC(C)C(C(C3O)O)O)C(C(C2O)O)O)cc2c1c(=O)cc(o2)c1ccc(c(c1)O)OC |
7-[[6-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-5-(2-hydroxyethoxy)-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one is a versatile compound widely used in chemical synthesis as a glycosylation agent. This compound plays a crucial role in the formation of glycosidic bonds in organic synthesis processes. By selectively attaching specific sugar residues to target molecules, it enables the creation of complex carbohydrate structures with precise control over stereochemistry and regiochemistry. Additionally, its unique structure containing a flavonoid core provides added functionality for potential biological applications.