AA22283
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $41.00 | $29.00 | - + | |
5g | 97% | in stock | $121.00 | $85.00 | - + | |
10g | 97% | in stock | $201.00 | $141.00 | - + | |
25g | 97% | in stock | $386.00 | $270.00 | - + | |
100g | 97% | in stock | $1,178.00 | $824.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA22283 |
Chemical Name: | 3-N-Boc-aminomethyl piperidine-hcl |
CAS Number: | 1159826-67-1 |
Molecular Formula: | C11H23ClN2O2 |
Molecular Weight: | 250.7655 |
MDL Number: | MFCD11101360 |
SMILES: | O=C(OC(C)(C)C)NCC1CCCNC1.Cl |
Complexity: | 211 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 4 |
Undefined Atom Stereocenter Count: | 1 |
The tert-Butyl (piperidin-3-ylmethyl)carbamate hydrochloride is a versatile chemical compound commonly used in chemical synthesis processes. With its unique structure and properties, this compound serves as a valuable building block in the creation of various organic molecules. In chemical synthesis, this compound can be employed as a key intermediate for the synthesis of pharmaceutical drugs, agrochemicals, and other fine chemicals. Its reactivity and stability make it a preferred choice for the modification of complex molecules, enabling chemists to achieve precise control over the synthesis process. Additionally, the tert-Butyl (piperidin-3-ylmethyl)carbamate hydrochloride plays a crucial role in the development of novel materials and bioactive compounds, showcasing its significance in advancing the field of organic chemistry.