logo
Home  > Edrophonium chloride

AA14516

116-38-1 | Edrophonium chloride

Packsize Purity Availability Price Discounted Price    Quantity
50mg 95% in stock $25.00 $18.00 -   +
100mg 95% in stock $44.00 $31.00 -   +
250mg 95% in stock $69.00 $49.00 -   +
500mg 95% in stock $129.00 $90.00 -   +
1g 95% in stock $167.00 $117.00 -   +
5g 95% in stock $513.00 $359.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA14516
Chemical Name: Edrophonium chloride
CAS Number: 116-38-1
Molecular Formula: C10H16ClNO
Molecular Weight: 201.6931
MDL Number: MFCD00055064
SMILES: CC[N+](c1cccc(c1)O)(C)C.[Cl-]
NSC Number: 759577

 

Computed Properties
Complexity: 145  
Covalently-Bonded Unit Count: 2  
Heavy Atom Count: 13  
Hydrogen Bond Acceptor Count: 2  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 2  

 

 

Upstream Synthesis Route 
  • Benzenaminium, N-ethyl-3-hydroxy-N,N-dimethyl-, chloride (1:1) is a versatile compound widely used in organic chemical synthesis. Its unique structure allows for its application in various chemical reactions, making it a valuable reagent in the laboratory.One primary use of this compound is as a catalyst in the synthesis of complex organic molecules. Its ability to facilitate specific chemical transformations makes it an essential tool for organic chemists working on intricate synthesis pathways. Additionally, Benzenaminium, N-ethyl-3-hydroxy-N,N-dimethyl-, chloride (1:1) can also serve as a stabilizing agent in certain reaction conditions, enhancing the overall yield and efficiency of the process.Furthermore, this compound can be utilized in the preparation of pharmaceutical intermediates due to its ability to control specific reaction pathways effectively. Its precise action in guiding chemical reactions makes it a valuable component in the synthesis of bioactive compounds and potential drug candidates. In summary, Benzenaminium, N-ethyl-3-hydroxy-N,N-dimethyl-, chloride (1:1) plays a crucial role in chemical synthesis by serving as a catalyst, stabilizer, and key intermediate in the production of complex organic molecules and pharmaceutical compounds.
Literature
FEATURED PRODUCTS