logo
Home  > Phosphine, [3,6-dimethoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]bis(tricyclo[3.3.1.13,7]dec-1-yl)-

AA14792

1160861-59-5 | Phosphine, [3,6-dimethoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]bis(tricyclo[3.3.1.13,7]dec-1-yl)-

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $128.00 $89.00 -   +
250mg 95% in stock $239.00 $167.00 -   +
1g 95% in stock $950.00 $665.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA14792
Chemical Name: Phosphine, [3,6-dimethoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]bis(tricyclo[3.3.1.13,7]dec-1-yl)-
CAS Number: 1160861-59-5
Molecular Formula: C43H61O2P
Molecular Weight: 640.917
MDL Number: MFCD23379935
SMILES: COc1ccc(c(c1c1c(cc(cc1C(C)C)C(C)C)C(C)C)P(C12CC3CC(C2)CC(C1)C3)C12CC3CC(C2)CC(C1)C3)OC

 

Upstream Synthesis Route
  • Di(adamantan-1-yl)(2',4',6'-triisopropyl-3,6-dimethoxy-[1,1'-biphenyl]-2-yl)phosphine is a versatile compound utilized in chemical synthesis for its ability to serve as a valuable ligand in various catalytic processes. This phosphine ligand exhibits remarkable steric and electronic properties that make it particularly well-suited for promoting challenging bond-forming reactions in organic chemistry. When employed in transition metal-catalyzed cross-coupling reactions, this compound has been shown to facilitate the formation of complex molecular architectures with high efficiency and selectivity. Its unique structural features allow for precise control over the coordination environment of the metal center, leading to enhanced reactivity and enabling the synthesis of a wide range of organic molecules with pharmaceutical, agrochemical, and materials science applications. In summary, Di(adamantan-1-yl)(2',4',6'-triisopropyl-3,6-dimethoxy-[1,1'-biphenyl]-2-yl)phosphine plays a crucial role in advancing the field of chemical synthesis by enabling the streamlined and sustainable production of valuable compounds with diverse functionalities.
FEATURED PRODUCTS