AA16570
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $18.00 | $12.00 | - + | |
10mg | 98% | in stock | $26.00 | $18.00 | - + | |
25mg | 98% | in stock | $39.00 | $27.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA16570 |
Chemical Name: | 9H-CARBAZOLE-9-PROPANOIC ACID, 3-[[(4-FLUOROPHENYL)SULFONYL]AMINO]-1,2,3,4-TETRAHYDRO-, (3R)- |
CAS Number: | 116649-85-5 |
Molecular Formula: | C21H21FN2O4S |
Molecular Weight: | 416.4658 |
MDL Number: | MFCD00887606 |
SMILES: | OC(=O)CCn1c2CC[C@H](Cc2c2c1cccc2)NS(=O)(=O)c1ccc(cc1)F |
Ramatroban, a potent and selective antagonist of the thromboxane A2 (TXA2) receptor, plays a crucial role in chemical synthesis as a valuable tool in the development of novel pharmaceutical compounds. By effectively blocking the TXA2 receptor, Ramatroban inhibits the vasoconstrictive and pro-inflammatory effects mediated by TXA2, making it a valuable agent in the synthesis of anti-inflammatory and anti-thrombotic drugs. Furthermore, its ability to modulate immune responses and platelet aggregation provides a unique platform for the design and synthesis of innovative therapeutic agents targeting various cardiovascular and inflammatory conditions. In chemical synthesis, Ramatroban's distinctive properties offer researchers the opportunity to explore new pathways and mechanisms in drug discovery, ultimately leading to the development of advanced medication options for diverse medical conditions.