AE11221
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99+% | in stock | $34.00 | $24.00 | - + | |
2mg | 99+% | in stock | $57.00 | $40.00 | - + | |
5mg | 99+% | in stock | $84.00 | $59.00 | - + | |
10mg | 99+% | in stock | $126.00 | $88.00 | - + | |
50mg | 99+% | in stock | $335.00 | $235.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11221 |
Chemical Name: | Gdc-0623 |
CAS Number: | 1168091-68-6 |
Molecular Formula: | C16H14FIN4O3 |
Molecular Weight: | 456.2102 |
MDL Number: | MFCD25976760 |
SMILES: | OCCONC(=O)c1ccc2n(c1Nc1ccc(cc1F)I)cnc2 |
Complexity: | 461 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 6 |
XLogP3: | 3.7 |
Bioorganic & medicinal chemistry letters 20141001
Nature 20130912
Journal of hematology & oncology 20130101