AE09389
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $23.00 | $16.00 | - + | |
2g | 95% | in stock | $44.00 | $31.00 | - + | |
5g | 95% | in stock | $73.00 | $51.00 | - + | |
10g | 95% | in stock | $124.00 | $87.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE09389 |
Chemical Name: | N-(2-Aminoethyl)-5-isoquinolinesulfonamide hydrochloride |
CAS Number: | 116970-50-4 |
Molecular Formula: | C11H14ClN3O2S |
Molecular Weight: | 287.7658 |
MDL Number: | MFCD00083242 |
SMILES: | NCCNS(=O)(=O)c1cccc2c1ccnc2.Cl |
Complexity: | 339 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 4 |
5-Isoquinolinesulfonamide, N-(2-aminoethyl)-, hydrochloride (1:1) is a key chemical compound that finds its application in various chemical synthesis processes. It serves as a versatile building block in the creation of pharmaceuticals, agrochemicals, and other fine chemicals due to its unique structural properties. This compound is particularly valued for its ability to participate in numerous functional group transformations, making it a valuable tool in organic synthesis. Additionally, its hydrochloride form enhances its solubility in aqueous media, which is crucial for reactions that require a polar environment. In synthesis, 5-Isoquinolinesulfonamide, N-(2-aminoethyl)-, hydrochloride (1:1) is utilized as a precursor for the generation of diverse molecular frameworks, enabling the construction of complex molecules with specific biological or chemical activities. Its incorporation in synthetic routes contributes significantly to the development of novel compounds with potential applications across various industries.