AA17314
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 96% | in stock | $8.00 | $6.00 | - + | |
10g | 96% | in stock | $10.00 | $7.00 | - + | |
25g | 96% | in stock | $12.00 | $9.00 | - + | |
100g | 96% | in stock | $45.00 | $32.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA17314 |
Chemical Name: | 1-Naphthol-5-sulfonic acid |
CAS Number: | 117-59-9 |
Molecular Formula: | C10H8O4S |
Molecular Weight: | 224.2331 |
MDL Number: | MFCD00065326 |
SMILES: | Oc1cccc2c1cccc2S(=O)(=O)O |
Complexity: | 319 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 0.9 |
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20090401
Huan jing ke xue= Huanjing kexue 20070801
Journal of medicinal chemistry 19710701