logo
Home  > Tetraethyl 2,2',2'',2'''-(((3',6'-dihydroxy-3-oxo-3h-spiro[isobenzofuran-1,9'-xanthene]-4',5'-diyl)bis(methylene))bis(azanetriyl))tetraacetate

AA17518

1170856-93-5 | Tetraethyl 2,2',2'',2'''-(((3',6'-dihydroxy-3-oxo-3h-spiro[isobenzofuran-1,9'-xanthene]-4',5'-diyl)bis(methylene))bis(azanetriyl))tetraacetate

Packsize Purity Availability Price Discounted Price    Quantity
1mg 95% in stock $49.00 $35.00 -   +
5mg 95% in stock $214.00 $150.00 -   +
10mg 95% in stock $376.00 $263.00 -   +
25mg 95% in stock $821.00 $575.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA17518
Chemical Name: Tetraethyl 2,2',2'',2'''-(((3',6'-dihydroxy-3-oxo-3h-spiro[isobenzofuran-1,9'-xanthene]-4',5'-diyl)bis(methylene))bis(azanetriyl))tetraacetate
CAS Number: 1170856-93-5
Molecular Formula: C38H42N2O13
Molecular Weight: 734.7457
MDL Number: MFCD14586332
SMILES: CCOC(=O)CN(Cc1c(O)ccc2c1Oc1c(CN(CC(=O)OCC)CC(=O)OCC)c(O)ccc1C12OC(=O)c2c1cccc2)CC(=O)OCC

 

Upstream Synthesis Route 
  • Tetraethyl Fluorescein Bis(methylene)bis(azanetriyl)tetraacetate is a versatile compound widely used in chemical synthesis as a fluorescent labeling agent. This compound allows for precise tracking and visualization of molecules within a reaction or system. Its unique structure enables it to bind to specific targets, enabling researchers to monitor the progress of reactions, study molecular interactions, and identify potential contaminants. By incorporating Tetraethyl Fluorescein Bis(methylene)bis(azanetriyl)tetraacetate into their experimental designs, chemists can gain valuable insights into the mechanisms underlying various chemical processes.
FEATURED PRODUCTS