logo
Home  > 5-Phenylpyridin-3-ylboronic acid pinacol ester

AA17773

1171891-07-8 | 5-Phenylpyridin-3-ylboronic acid pinacol ester

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $65.00 $45.00 -   +
250mg 95% in stock $119.00 $83.00 -   +
1g 95% in stock $308.00 $215.00 -   +
5g 95% in stock $1,185.00 $830.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA17773
Chemical Name: 5-Phenylpyridin-3-ylboronic acid pinacol ester
CAS Number: 1171891-07-8
Molecular Formula: C17H20BNO2
Molecular Weight: 281.1572
MDL Number: MFCD13182146
SMILES: CC1(C)OB(OC1(C)C)c1cncc(c1)c1ccccc1

 

Upstream Synthesis Route 
  • 3-Phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, commonly used as a reagent in chemical synthesis, serves as an essential building block for constructing complex organic molecules. Its unique structural features make it a versatile tool in organic chemistry applications. By employing this compound, chemists can efficiently introduce the 1,3,2-dioxaborolane moiety into various target molecules, enabling the formation of C-C and C-N bonds in a controlled manner. This specific functionality allows for the development of novel pharmaceuticals, agrochemicals, and materials with tailored properties. Additionally, the presence of the pyridine group further enhances its reactivity and compatibility in a wide range of synthetic transformations, making it a valuable asset in modern organic synthesis strategies.
FEATURED PRODUCTS