1172075-67-0 | 2-Benzo[b]thiopheneglyoxal hydrate

Availability
Typically In Stock

Description

• Catalog Number: AA17844
• Chemical Name: 2-Benzo[b]thiopheneglyoxal hydrate
• CAS Number: 1172075-67-0
• Molecular Formula: C10H8O3S
• Molecular Weight: 208.2337
• MDL Number: MFCD28053794
• SMILES: O=CC(=O)c1cc2c(s1)cccc2.O

Upstream Synthesis Route

The compound 2-(Benzo[b]thiophen-2-yl)-2-oxoacetaldehyde hydrate is a versatile chemical reagent commonly used in organic synthesis processes. It serves as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and fine chemicals due to its unique structure and reactivity.In chemical synthesis, this compound is particularly valuable for its ability to undergo various transformations, such as condensation reactions, cyclizations, and functional group modifications. It can be used as a building block for the synthesis of heterocyclic compounds, which are essential in drug discovery and development. Additionally, the presence of the benzo[b]thiophene moiety in the molecule imparts specific properties that are beneficial in designing bioactive molecules.Furthermore, the oxoacetaldehyde functionality in this compound plays a crucial role in facilitating the formation of carbon-carbon and carbon-heteroatom bonds, making it a valuable tool in the construction of complex molecular architectures. Its hydrate form also contributes to the solubility and stability of the compound, allowing for easier handling in various synthetic procedures.Overall, 2-(Benzo[b]thiophen-2-yl)-2-oxoacetaldehyde hydrate is a valuable tool in the hands of synthetic chemists, enabling the efficient and precise construction of diverse chemical structures with potential applications in the fields of medicine, agriculture, and materials science.