logo
Home  > Chemistry  > Organic Building Blocks  > Trifluoromethyls  > Methyl 2-amino-5-(trifluoromethyl)benzoate

AA18132

117324-58-0 | Methyl 2-amino-5-(trifluoromethyl)benzoate

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $19.00 $13.00 -   +
5g 95% in stock $25.00 $18.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA18132
Chemical Name: Methyl 2-amino-5-(trifluoromethyl)benzoate
CAS Number: 117324-58-0
Molecular Formula: C9H8F3NO2
Molecular Weight: 219.1605
MDL Number: MFCD08234902
SMILES: COC(=O)c1cc(ccc1N)C(F)(F)F

 

Computed Properties
Complexity: 242  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 15  
Hydrogen Bond Acceptor Count: 6  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 2  
XLogP3: 2.8  

 

 

Upstream Synthesis Route
  • Methyl 2-amino-5-(trifluoromethyl)benzoate is a versatile compound primarily used in chemical synthesis processes as a key building block. With its unique molecular structure, this compound plays a crucial role in the development of various pharmaceuticals, agrochemicals, and materials.In chemical synthesis, Methyl 2-amino-5-(trifluoromethyl)benzoate is commonly employed as a precursor in the creation of diverse organic compounds. Its trifluoromethyl group provides enhanced reactivity and allows for the introduction of fluorine atoms into target molecules, which is valuable in medicinal chemistry and material science.Additionally, the amino and ester functional groups in Methyl 2-amino-5-(trifluoromethyl)benzoate enable the formation of peptide bonds and ester linkages, making it a pivotal intermediate in the synthesis of complex molecules. Its multifaceted reactivity and compatibility with various synthetic routes make it a valuable tool in the hands of organic chemists for constructing intricate molecular structures efficiently.Overall, Methyl 2-amino-5-(trifluoromethyl)benzoate serves as a crucial component in the intricate web of chemical synthesis, empowering researchers and chemists to develop innovative substances with diverse applications in pharmaceuticals, agrochemicals, and materials science.
FEATURED PRODUCTS