logo
Home  > 6-Benzothiazolecarboxylic acid, 2-hydrazinyl-

AA18151

117342-15-1 | 6-Benzothiazolecarboxylic acid, 2-hydrazinyl-

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA18151
Chemical Name: 6-Benzothiazolecarboxylic acid, 2-hydrazinyl-
CAS Number: 117342-15-1
Molecular Formula: C8H7N3O2S
Molecular Weight: 209.2251
MDL Number: MFCD18822337
SMILES: NNc1nc2c(s1)cc(cc2)C(=O)O

 

Upstream Synthesis Route
  • 6-Benzothiazolecarboxylic acid, 2-hydrazinyl- is a versatile building block in chemical synthesis, commonly utilized for the preparation of various functional materials and pharmaceutical compounds. This compound serves as a key intermediate in the synthesis of biologically active molecules and can be readily modified to introduce specific functionalities and properties. Its hydrazine group enables it to participate in condensation reactions, forming hydrazones and azo compounds, which are essential in the development of dyes, pigments, and corrosion inhibitors. Additionally, the benzothiazole ring provides aromaticity and electron density, allowing for further functionalization through various chemical transformations such as acylation, alkylation, and oxidation. This compound's unique structure and reactivity make it an indispensable tool in the synthesis of diverse compounds with potential applications in pharmaceuticals, materials science, and organic chemistry.
FEATURED PRODUCTS