117467-73-9 | Cbz-4-fluoro-d-phe

Packsize	Purity	Availability	Price	Discounted Price
250mg	98%	in stock	$105.00	$74.00
1g	98%	in stock	$249.00	$175.00
5g	98%	in stock	$758.00	$531.00
10g	98%	in stock	$1,317.00	$922.00
25g	98%	in stock	$2,484.00	$1,739.00

Description

• Catalog Number: AA18404
• Chemical Name: Cbz-4-fluoro-d-phe
• CAS Number: 117467-73-9
• Molecular Formula: C17H16FNO4
• Molecular Weight: 317.3116
• MDL Number: MFCD00797571
• SMILES: O=C(N[C@@H](C(=O)O)Cc1ccc(cc1)F)OCc1ccccc1

Upstream Synthesis Route

Z-D-Phe(4-F)-OH, or Z-4-Fluorophenylalanine, is a crucial amino acid derivative widely used in chemical synthesis processes. This compound is particularly valued for its unique properties that make it instrumental in various aspects of organic chemistry.In chemical synthesis, Z-D-Phe(4-F)-OH serves as a versatile building block for the creation of peptide and protein structures. Its incorporation allows for the introduction of specific functionalities and structural modifications that can influence the overall properties and functions of the target molecules. Additionally, the presence of the Z-protecting group confers stability and enables selective deprotection under controlled conditions, facilitating precise manipulation during synthesis.Furthermore, the 4-fluoro substituent on the phenylalanine side chain imparts distinctive characteristics to the resulting peptides or proteins. This fluorine moiety can participate in various interactions, such as hydrogen bonding and hydrophobic interactions, thereby influencing the conformation and binding properties of the synthesized compounds. Additionally, the fluorine atom's unique electronic properties can enhance the stability and bioavailability of the final products, making them valuable components in drug discovery and development.Overall, Z-D-Phe(4-F)-OH plays a crucial role in chemical synthesis by providing a strategic tool for designing and constructing complex molecular structures with tailored functionalities and properties. Its versatility and impact across diverse fields, ranging from pharmaceuticals to materials science, highlight its significance as a key component in the synthesis toolbox.