logo
Home  > 1-(Piperidin-4-yl)-1H-pyrazole-boronic acid pinacol ester

AI11103

1175708-03-8 | 1-(Piperidin-4-yl)-1H-pyrazole-boronic acid pinacol ester

Packsize Purity Availability Price Discounted Price    Quantity
250mg 96% in stock $242.00 $169.00 -   +
1g 96% in stock $633.00 $443.00 -   +
5g 96% in stock $2,205.00 $1,544.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AI11103
Chemical Name: 1-(Piperidin-4-yl)-1H-pyrazole-boronic acid pinacol ester
CAS Number: 1175708-03-8
Molecular Formula: C14H24BN3O2
Molecular Weight: 277.1703
MDL Number: MFCD18383254
SMILES: CC1(C)OB(OC1(C)C)c1cnn(c1)C1CCNCC1

 

Upstream Synthesis Route 
  • The compound 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]piperidine has a wide range of applications in chemical synthesis. Its unique structure allows it to serve as a versatile building block in the creation of complex organic molecules. This compound is particularly useful in the formation of heterocyclic compounds and pharmaceutical intermediates. Its boron-containing moiety can participate in various cross-coupling reactions, allowing for the introduction of diverse functional groups. Additionally, the piperidine ring offers potential for further modification through functional group manipulations. Overall, the compound plays a crucial role in the construction of structurally intricate molecules with potential applications in medicinal chemistry and material science.
FEATURED PRODUCTS