logo
Home  > Life Science  > Amino acids  > Amino acid derivatives  > Boc-d-bpa-oh

AB71430

117666-94-1 | Boc-d-bpa-oh

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $90.00 $63.00 -   +
1g 95% in stock $130.00 $91.00 -   +
5g 95% in stock $438.00 $306.00 -   +
25g 95% in stock $1,522.00 $1,065.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB71430
Chemical Name: Boc-d-bpa-oh
CAS Number: 117666-94-1
Molecular Formula: C21H23NO5
Molecular Weight: 369.411
MDL Number: MFCD00237572
SMILES: O=C(OC(C)(C)C)N[C@@H](C(=O)O)Cc1ccc(cc1)C(=O)c1ccccc1

 

Computed Properties
Complexity: 525  
Covalently-Bonded Unit Count: 1  
Defined Atom Stereocenter Count: 1  
Heavy Atom Count: 27  
Hydrogen Bond Acceptor Count: 5  
Hydrogen Bond Donor Count: 2  
Rotatable Bond Count: 8  
XLogP3: 3.2  

 

 

Upstream Synthesis Route
  • The (R)-3-(4-Benzoylphenyl)-2-((tert-butoxycarbonyl)amino)propanoic acid is a versatile compound commonly used in chemical synthesis due to its unique structural properties. This compound serves as a crucial building block in the creation of various pharmaceuticals, agrochemicals, and advanced materials. Its chiral nature allows for precise control over the stereochemistry of the synthesized molecules, making it highly valuable in the production of enantiomerically pure compounds. Additionally, the presence of the benzoylphenyl moiety provides a reactive site for further functionalization, enabling the synthesis of complex molecules with specific biological or physicochemical properties. The (R)-3-(4-Benzoylphenyl)-2-((tert-butoxycarbonyl)amino)propanoic acid plays a key role in the development of new chemical entities and contributes significantly to the advancement of synthetic chemistry.
FEATURED PRODUCTS