117685-48-0 | 6-Fluoro-4-oxo-1,4-dihydro-3-quinolinecarboxylic acid

Packsize	Purity	Availability	Price	Discounted Price
1g	98%	in stock	$251.00	$176.00
5g	98%	in stock	$744.00	$521.00

Description

• Catalog Number: AD36209
• Chemical Name: 6-Fluoro-4-oxo-1,4-dihydro-3-quinolinecarboxylic acid
• CAS Number: 117685-48-0
• Molecular Formula: C10H6FNO3
• Molecular Weight: 207.1579
• MDL Number: MFCD03425825
• SMILES: Fc1ccc2c(c1)c(=O)c(c[nH]2)C(=O)O

Upstream Synthesis Route

6-Fluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid, commonly known as $name$, plays a crucial role in chemical synthesis. This compound is frequently utilized as a key intermediate in the production of various pharmaceuticals and agrochemicals. Its unique structure and reactivity make it an essential building block for the synthesis of complex organic molecules.In chemical synthesis, $name$ serves as a versatile starting material for the preparation of a wide range of quinoline-based compounds. Its fluoro substituent enhances the compound's reactivity and selectivity in various reactions, making it particularly valuable in medicinal chemistry and drug development. By introducing specific functional groups to the quinoline ring system, chemists can tailor the properties of the resulting molecules for specific applications.Moreover, the presence of the carboxylic acid group in $name$ allows for further derivatization through various chemical transformations. This functional group serves as a point of attachment for other molecules, enabling the synthesis of more complex structures with desired properties. Overall, the application of 6-Fluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid in chemical synthesis showcases its importance as a versatile and effective building block in organic chemistry.