AV80525
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | 3 weeks | $574.00 | $402.00 | - + | |
5mg | 95% | 3 weeks | $639.00 | $447.00 | - + | |
10mg | 95% | 3 weeks | $685.00 | $479.00 | - + | |
25mg | 95% | 3 weeks | $850.00 | $595.00 | - + | |
50mg | 95% | 3 weeks | $1,194.00 | $836.00 | - + | |
100mg | 95% | 3 weeks | $1,654.00 | $1,158.00 | - + | |
1g | 95% | 3 weeks | $2,370.00 | $1,659.00 | - + | |
5g | 95% | 3 weeks | $6,649.00 | $4,655.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AV80525 |
Chemical Name: | 3-BIPHENYL-4-YL-1-METHYL-1(H)-PYRAZOLE-5-CARBOXYLIC ACID |
CAS Number: | 1177282-64-2 |
Molecular Formula: | C17H14N2O2 |
Molecular Weight: | 278.3053 |
MDL Number: | MFCD16652628 |
SMILES: | OC(=O)c1cc(nn1C)c1ccc(cc1)c1ccccc1 |
The 3-biphenyl-4-yl-1-methyl-1H-pyrazole-5-carboxylic acid is a versatile compound commonly used in organic chemical synthesis. This particular molecule serves as a valuable building block in the creation of various organic compounds due to its functional groups and structural properties. In chemical synthesis, this compound can be utilized as a key intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Its unique structure allows for the introduction of different functional groups and modifications, enabling the creation of diverse derivatives with tailored properties and applications. Additionally, the 3-biphenyl-4-yl-1-methyl-1H-pyrazole-5-carboxylic acid exhibits reactivity that can participate in various reactions, such as coupling reactions, substitution reactions, and condensation reactions, making it a valuable tool for synthetic chemists in designing and developing novel compounds for a wide range of applications.