AE08271
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $16.00 | $12.00 | - + | |
25g | 98% | in stock | $19.00 | $13.00 | - + | |
100g | 98% | in stock | $38.00 | $26.00 | - + | |
500g | 98% | in stock | $136.00 | $95.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE08271 |
Chemical Name: | MES hemisodium salt |
CAS Number: | 117961-21-4 |
Molecular Formula: | C12H25N2NaO8S2 |
Molecular Weight: | 412.4552699999998 |
MDL Number: | MFCD00079460 |
SMILES: | [O-]S(=O)(=O)CCN1CCOCC1.OS(=O)(=O)CCN1CCOCC1.[Na+] |
Complexity: | 434 |
Covalently-Bonded Unit Count: | 3 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 10 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
The application of Sodium 2-morpholinoethanesulfonate(1:2) in chemical synthesis involves its utilization as a highly effective buffering agent in a variety of reactions. This compound serves as a crucial catalyst in organic synthesis procedures, facilitating the formation of desired products by controlling the pH levels of the reaction environment. Its unique chemical properties make it particularly suitable for use in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. Additionally, Sodium 2-morpholinoethanesulfonate(1:2) can act as a stabilizing agent for certain reactive intermediates, enhancing the overall efficiency and yield of the synthesis process.