1184-68-5 | Guanidinium sulphate

Availability
Typically In Stock

Description

• Catalog Number: AD74524
• Chemical Name: Guanidinium sulphate
• CAS Number: 1184-68-5
• Molecular Formula: C2H12N6O4S
• Molecular Weight: 216.2195
• SMILES: [O-]S(=O)(=O)[O-].NC(=N)[NH3+].NC(=N)[NH3+]

Upstream Synthesis Route

Guanidine sulfate is a highly versatile compound widely utilized in various chemical synthesis processes. Its unique properties make it an essential reagent in organic chemistry, specifically in the production of pharmaceuticals, polymers, and agricultural chemicals. In organic synthesis, guanidine sulfate serves as a powerful nucleophilic catalyst, enabling the formation of carbon-carbon and carbon-nitrogen bonds in complex molecules. Its ability to act as a base facilitates the activation of substrates and accelerates reaction rates, leading to more efficient and selective transformations.Furthermore, guanidine sulfate plays a crucial role in the synthesis of heterocyclic compounds, which are essential building blocks in pharmaceutical research and development. By participating in key reactions such as cyclizations and condensations, it enables the generation of diverse chemical structures with desired pharmacological properties.Overall, guanidine sulfate is a valuable tool in the hands of chemists, allowing for the construction of intricate molecular architectures and the discovery of novel compounds with potential applications in various industries. Its versatility and efficacy make it an indispensable component in the toolkit of synthetic chemists seeking to push the boundaries of chemical synthesis.