118441-84-2 | β-D-Glucopyranosiduronic acid, (3β,4β,20β)-20-carboxy-23-hydroxy-11-oxo-30-norolean-12-en-3-yl 2-O-β-D-glucopyranuronosyl-

Packsize	Purity	Availability	Price	Discounted Price
5mg	99%	1 week	$560.00	$392.00
10mg	99%	1 week	$786.00	$550.00

Description

• Catalog Number: BC54921
• Chemical Name: β-D-Glucopyranosiduronic acid, (3β,4β,20β)-20-carboxy-23-hydroxy-11-oxo-30-norolean-12-en-3-yl 2-O-β-D-glucopyranuronosyl-
• CAS Number: 118441-84-2
• Molecular Formula: C42H62O17
• Molecular Weight: 838.9315
• SMILES: OC[C@@]1(C)[C@H](CC[C@]2([C@H]1CC[C@@]1([C@@H]2C(=O)C=C2[C@@]1(C)CC[C@@]1([C@H]2C[C@@](CC1)(C)C(=O)O)C)C)C)O[C@@H]1O[C@H](C(=O)O)[C@H]([C@@H]([C@H]1O[C@@H]1O[C@H](C(=O)O)[C@H]([C@@H]([C@H]1O)O)O)O)O

Upstream Synthesis Route

Licoricesaponin G2, a triterpenoid saponin compound derived from licorice root, plays a crucial role in chemical synthesis as a versatile reagent. With its unique structure and properties, Licoricesaponin G2 is commonly utilized as a key intermediate in the synthesis of various pharmaceutical compounds, natural products, and functional materials. Its ability to serve as a scaffold for various chemical modifications, such as glycosylation, acylation, and oxidation, makes it a valuable building block in the development of novel drug candidates and bioactive molecules. Additionally, Licoricesaponin G2 exhibits promising biological activities, including anti-inflammatory, anti-cancer, and anti-viral effects, further expanding its utility in medicinal chemistry and drug discovery research. The application of Licoricesaponin G2 in chemical synthesis showcases its potential to contribute to the advancement of diverse scientific fields and the development of innovative applications.