logo
Home  > 4SC-202

AE11087

1186222-89-8 | 4SC-202

Packsize Purity Availability Price Discounted Price    Quantity
5mg 98% in stock $202.00 $141.00 -   +
10mg 98% in stock $310.00 $217.00 -   +
25mg 98% in stock $596.00 $417.00 -   +
50mg 98% in stock $814.00 $570.00 -   +
100mg 98% in stock $1,234.00 $864.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE11087
Chemical Name: 4SC-202
CAS Number: 1186222-89-8
Molecular Formula: C30H29N5O6S2
Molecular Weight: 619.7112
MDL Number: MFCD25976779
SMILES: O=C(Nc1ccccc1N)/C=C/c1ccn(c1)S(=O)(=O)c1ccc(cc1)c1cnn(c1)C.Cc1ccc(cc1)S(=O)(=O)O

 

Upstream Synthesis Route
  • In chemical synthesis, (2E)-N-(2-Aminophenyl)-3-[1-[[4-(1-methyl-1H-pyrazol-4-yl)phenyl]sulfonyl]-1H-pyrrol-3-yl]-2-propenamide 4-methylbenzenesulfonate can serve as a versatile reagent for the construction of complex organic molecules. This compound's unique structure enables it to participate in various reactions such as amide bond formation, sulfonamide synthesis, and conjugate addition. Additionally, the presence of both aromatic and heterocyclic moieties enhances its utility in diversifying the chemical space of the target molecules. Its application in chemical synthesis allows for the efficient incorporation of multiple functional groups, making it a valuable tool for the preparation of structurally intricate compounds.
FEATURED PRODUCTS