logo
Home  > (R)-2,2,2-Trifluoro-1-(4-(trifluoromethyl)phenyl)ethanamine

AD74237

1187928-03-5 | (R)-2,2,2-Trifluoro-1-(4-(trifluoromethyl)phenyl)ethanamine

Packsize Purity Availability Price Discounted Price    Quantity
500mg 97% 2 weeks $753.00 $527.00 -   +
1g 97% 2 weeks $1,229.00 $860.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AD74237
Chemical Name: (R)-2,2,2-Trifluoro-1-(4-(trifluoromethyl)phenyl)ethanamine
CAS Number: 1187928-03-5
Molecular Formula: C9H7F6N
Molecular Weight: 243.149
MDL Number: MFCD07374577
SMILES: N[C@@H](C(F)(F)F)c1ccc(cc1)C(F)(F)F

 

Upstream Synthesis Route 
  • The (R)-2,2,2-Trifluoro-1-(4-(trifluoromethyl)phenyl)ethanamine plays a crucial role in chemical synthesis as a versatile building block. Its unique molecular structure and reactivity make it an essential component in the development of various pharmaceuticals, agrochemicals, and materials. This compound is frequently employed in asymmetric synthesis to introduce chiral information into complex molecules. Additionally, (R)-2,2,2-Trifluoro-1-(4-(trifluoromethyl)phenyl)ethanamine serves as an important intermediate in the preparation of fluorinated compounds, which exhibit enhanced bioactivity and physicochemical properties. Its incorporation leads to the modulation of chemical and biological interactions, making it a valuable tool in modern synthetic chemistry strategies.
FEATURED PRODUCTS