AB51376
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $25.00 | $17.00 | - + | |
5g | 98% | in stock | $41.00 | $29.00 | - + | |
25g | 98% | in stock | $113.00 | $79.00 | - + | |
100g | 98% | in stock | $386.00 | $270.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB51376 |
Chemical Name: | Tert-Butyl 2-(2-hydroxyethyl)piperidine-1-carboxylate |
CAS Number: | 118811-03-3 |
Molecular Formula: | C12H23NO3 |
Molecular Weight: | 229.3159 |
MDL Number: | MFCD03701252 |
SMILES: | OCCC1CCCCN1C(=O)OC(C)(C)C |
Complexity: | 235 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 1.7 |
The Journal of organic chemistry 20031128