AE08807
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97% | in stock | $39.00 | $27.00 | - + | |
5mg | 97% | in stock | $79.00 | $55.00 | - + | |
10mg | 97% | in stock | $117.00 | $82.00 | - + | |
25mg | 97% | in stock | $233.00 | $163.00 | - + | |
50mg | 97% | in stock | $427.00 | $299.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE08807 |
Chemical Name: | NBQX disodium salt |
CAS Number: | 118876-58-7 |
Molecular Formula: | C12H6N4Na2O6S |
Molecular Weight: | 380.2438 |
MDL Number: | MFCD11046016 |
SMILES: | [O-][N+](=O)c1cc2nc([O-])c(nc2c2c1c(ccc2)S(=O)(=O)N)[O-].[Na+].[Na+] |
1,2,3,4-Tetrahydro-6-nitro-2,3-dioxobenzo[f]quinoxaline-7-sulfonamide is a versatile compound commonly used in chemical synthesis processes. This compound serves as a key building block in the creation of various pharmaceuticals and agrochemicals. Its unique structure and properties make it particularly valuable in the development of new molecules with potential biological activities.In chemical synthesis, 1,2,3,4-Tetrahydro-6-nitro-2,3-dioxobenzo[f]quinoxaline-7-sulfonamide plays a crucial role as a precursor for the synthesis of heterocyclic compounds. Its sulfonamide functional group can undergo various transformations, allowing for the introduction of different substituents and modifications to the molecule. This flexibility enables chemists to create a wide range of derivatives that can be further evaluated for their pharmacological or agricultural properties.Moreover, the nitro and dioxo groups present in 1,2,3,4-Tetrahydro-6-nitro-2,3-dioxobenzo[f]quinoxaline-7-sulfonamide offer opportunities for further derivatization through reduction or functionalization reactions. These modifications can lead to the synthesis of novel compounds with enhanced potency or selectivity for specific targets.Overall, the application of 1,2,3,4-Tetrahydro-6-nitro-2,3-dioxobenzo[f]quinoxaline-7-sulfonamide in chemical synthesis provides chemists with a valuable tool for exploring new chemical space and developing potentially valuable molecules for various applications.