AE14833
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 95% | 2 weeks | $429.00 | $300.00 | - + | |
100mg | 95% | 2 weeks | $786.00 | $550.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE14833 |
Chemical Name: | 3-(2-(4-(6-Fluorobenzo[d]isoxazol-3-yl)piperidin-1-yl)ethyl)-2-methyl-7,8-dihydro-4H-pyrido[1,2-a]pyrimidine-4,9(6H)-dione |
CAS Number: | 1189516-65-1 |
Molecular Formula: | C23H25FN4O3 |
Molecular Weight: | 424.468 |
MDL Number: | MFCD23160663 |
SMILES: | Fc1ccc2c(c1)onc2C1CCN(CC1)CCc1c(C)nc2n(c1=O)CCCC2=O |
The compound $name$ serves as a versatile building block in chemical synthesis, particularly in the development of novel pharmaceutical agents. Its unique structure incorporates a fused pyrido[1,2-a]pyrimidine ring system, offering a valuable scaffold for medicinal chemistry endeavors. When utilized in chemical synthesis, this compound can be strategically manipulated to introduce diverse functional groups at various positions, enabling the creation of analogs with enhanced biological activities. By incorporating $name$ into synthetic pathways, chemists can access a wide array of structurally related derivatives for exploring structure-activity relationships and optimizing pharmacological properties.