AB53075
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $13.00 | $10.00 | - + | |
1g | 98% | in stock | $38.00 | $27.00 | - + | |
5g | 98% | in stock | $189.00 | $133.00 | - + | |
10g | 98% | in stock | $378.00 | $265.00 | - + | |
25g | 98% | in stock | $945.00 | $662.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB53075 |
Chemical Name: | 2-Methylindazole-5-boronic acid pinacol ester |
CAS Number: | 1189746-27-7 |
Molecular Formula: | C14H19BN2O2 |
Molecular Weight: | 258.1239 |
MDL Number: | MFCD11109436 |
SMILES: | Cn1nc2c(c1)cc(cc2)B1OC(C(O1)(C)C)(C)C |
Complexity: | 345 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 1 |
2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole, commonly referred to as $name$, is a versatile compound widely utilized in chemical synthesis as a key building block. This compound plays a crucial role in organic synthesis, particularly in the construction of complex molecules and pharmaceutical intermediates. Its strategic combination of functional groups makes it an essential tool for chemists seeking to introduce specific structural motifs into target molecules.