logo
Home  > 4,4'-Bis(dimethylamino)benzhydrol

AA32205

119-58-4 | 4,4'-Bis(dimethylamino)benzhydrol

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $105.00 $74.00 -   +
10g 95% in stock $204.00 $143.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA32205
Chemical Name: 4,4'-Bis(dimethylamino)benzhydrol
CAS Number: 119-58-4
Molecular Formula: C17H22N2O
Molecular Weight: 270.3694
MDL Number: MFCD00008313
SMILES: OC(c1ccc(cc1)N(C)C)c1ccc(cc1)N(C)C

 

Upstream Synthesis Route 
  • 4,4'-Bis(dimethylamino)benzhydrol is a versatile compound that finds wide applications in chemical synthesis. This compound is commonly utilized as a reducing agent in organic chemistry reactions. Its unique chemical structure allows it to facilitate the conversion of various functional groups by donating electrons. In addition, 4,4'-Bis(dimethylamino)benzhydrol is particularly useful in the synthesis of pharmaceutical compounds, where controlled reductions are crucial for achieving specific chemical structures. Its effectiveness in promoting selective reductions makes it a valuable tool in the development of new molecules with desired biological activities. This compound's ability to facilitate complex chemical transformations underscores its importance in modern organic synthesis strategies.
FEATURED PRODUCTS