logo
Home  > L-2-Trifluoromethylphenylalanine

AA32276

119009-47-1 | L-2-Trifluoromethylphenylalanine

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $84.00 $59.00 -   +
5g 98% in stock $233.00 $163.00 -   +
25g 98% in stock $882.00 $618.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA32276
Chemical Name: L-2-Trifluoromethylphenylalanine
CAS Number: 119009-47-1
Molecular Formula: C10H10F3NO2
Molecular Weight: 233.18710959999993
MDL Number: MFCD00077615
SMILES: OC(=O)[C@H](Cc1ccccc1C(F)(F)F)N

 

Upstream Synthesis Route 
  • (S)-2-Amino-3-(2-(trifluoromethyl)phenyl)propanoic acid is a versatile compound commonly utilized in chemical synthesis for its unique properties. This compound is often employed as a chiral building block in the creation of pharmaceuticals, agrochemicals, and various fine chemicals. Its chirality plays a crucial role in determining the stereochemistry of the final product, making it particularly valuable in asymmetric synthesis. By incorporating (S)-2-Amino-3-(2-(trifluoromethyl)phenyl)propanoic acid into a reaction sequence, chemists can control the formation of chiral centers, allowing for the production of enantiopure compounds. This compound's trifluoromethyl group further enhances its reactivity and can impart desirable pharmacokinetic properties to the end products. In summary, (S)-2-Amino-3-(2-(trifluoromethyl)phenyl)propanoic acid serves as a key component in the development of complex molecules with defined stereochemistry and diverse functionalities.
FEATURED PRODUCTS