logo
Home  > 3-(4-Fluorophenyl)picolinic acid

AA23713

1192608-90-4 | 3-(4-Fluorophenyl)picolinic acid

Packsize Purity Availability Price Discounted Price    Quantity
250mg 97% in stock $356.00 $249.00 -   +
1g 97% in stock $869.00 $608.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA23713
Chemical Name: 3-(4-Fluorophenyl)picolinic acid
CAS Number: 1192608-90-4
Molecular Formula: C12H8FNO2
Molecular Weight: 217.1958
MDL Number: MFCD14700040
SMILES: Fc1ccc(cc1)c1cccnc1C(=O)O

 

Upstream Synthesis Route
  • 3-(4-Fluorophenyl)picolinic acid is a versatile compound commonly used in chemical synthesis due to its unique properties and reactivity. As a substituted pyridine derivative, it serves as a valuable building block in the creation of various pharmaceuticals, agrochemicals, and materials.In chemical synthesis, 3-(4-Fluorophenyl)picolinic acid plays a crucial role as a starting material for the synthesis of heterocyclic compounds and coordination complexes. Its fluorine-substituted aromatic ring confers specific electronic and steric properties, influencing the reactivity and selectivity of the ensuing reactions.One of the primary applications of this compound is in the preparation of ligands for catalytic processes, such as in metal-catalyzed cross-coupling reactions and asymmetric catalysis. The functional groups present in 3-(4-Fluorophenyl)picolinic acid can be further modified to tailor the ligand's properties, enhancing its performance in various catalytic transformations.Moreover, this compound can also serve as a key intermediate for the synthesis of bioactive molecules, including pharmaceuticals and biologically active compounds. By strategically functionalizing the picolinic acid moiety, chemists can access a diverse array of derivatives with potential therapeutic applications.Overall, 3-(4-Fluorophenyl)picolinic acid is a valuable tool in the toolkit of synthetic chemists, offering a wide range of possibilities for the creation of complex molecules with tailored properties and functionalities. Its versatility and utility make it a sought-after compound in the field of chemical synthesis.
FEATURED PRODUCTS