logo
Home  > 1-Piperidineethanol, α-(4-chlorophenyl)-4-[(4-fluorophenyl)methyl]-

AA24084

119431-25-3 | 1-Piperidineethanol, α-(4-chlorophenyl)-4-[(4-fluorophenyl)methyl]-

Packsize Purity Availability Price Discounted Price    Quantity
1mg 98% in stock $43.00 $30.00 -   +
5mg 98% in stock $79.00 $55.00 -   +
10mg 98% in stock $110.00 $77.00 -   +
25mg 98% in stock $228.00 $159.00 -   +
50mg 98% in stock $296.00 $207.00 -   +
100mg 98% in stock $443.00 $310.00 -   +
250mg 98% in stock $665.00 $465.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA24084
Chemical Name: 1-Piperidineethanol, α-(4-chlorophenyl)-4-[(4-fluorophenyl)methyl]-
CAS Number: 119431-25-3
Molecular Formula: C20H23ClFNO
Molecular Weight: 347.8541
MDL Number: MFCD00866651
SMILES: Fc1ccc(cc1)CC1CCN(CC1)CC(c1ccc(cc1)Cl)O

 

Computed Properties
Complexity: 359  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 24  
Hydrogen Bond Acceptor Count: 3  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 5  
Undefined Atom Stereocenter Count: 1  
XLogP3: 4.5  

 

 

Upstream Synthesis Route 
  • Eliprodil is a versatile compound that finds widespread application in chemical synthesis. In organic synthesis, Eliprodil serves as a valuable building block for the construction of various complex molecules due to its unique structural features. Its functional groups enable efficient manipulation and modification, making it a sought-after reagent for the creation of diverse chemical structures.One of the key applications of Eliprodil in chemical synthesis is its role as a precursor in the formation of biologically active molecules. By leveraging the reactivity and flexibility of Eliprodil, chemists can efficiently access novel compounds with potential therapeutic properties. Furthermore, Eliprodil's compatibility with a range of reaction conditions and methodologies expands its utility in the synthesis of pharmaceutical intermediates and natural products.Moreover, Eliprodil can be employed in the development of innovative materials through controlled polymerization processes. Its tailored structure allows for precise tuning of molecular weight and branching, facilitating the production of advanced polymers with tailored properties such as mechanical strength, thermal stability, and optical characteristics.In summary, Eliprodil's significance in chemical synthesis lies in its versatility and applicability across various domains, enabling chemists to explore new avenues in drug discovery, materials science, and beyond.
Literature
FEATURED PRODUCTS