logo
Home  > 1-({2-[2-chloro-4-(4-chlorophenoxy)phenyl]-4-methyl-1,3-dioxolan-2-yl}methyl)-1H-1,2,4-triazole

AA24144

119446-68-3 | 1-({2-[2-chloro-4-(4-chlorophenoxy)phenyl]-4-methyl-1,3-dioxolan-2-yl}methyl)-1H-1,2,4-triazole

Packsize Purity Availability Price Discounted Price    Quantity
5g 95% in stock $37.00 $26.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA24144
Chemical Name: 1-({2-[2-chloro-4-(4-chlorophenoxy)phenyl]-4-methyl-1,3-dioxolan-2-yl}methyl)-1H-1,2,4-triazole
CAS Number: 119446-68-3
Molecular Formula: C19H17Cl2N3O3
Molecular Weight: 406.26258000000007
MDL Number: MFCD00144119
SMILES: CC1COC(O1)(Cn1cncn1)c1ccc(cc1Cl)Oc1ccc(cc1)Cl

 

Computed Properties
Complexity: 495  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 27  
Hydrogen Bond Acceptor Count: 5  
Rotatable Bond Count: 5  
Undefined Atom Stereocenter Count: 2  
XLogP3: 4  

 

 

Upstream Synthesis Route 
  • The compound $name$ plays a crucial role in chemical synthesis as a versatile building block. Its unique structure consisting of a 1H-1,2,4-triazole ring and a dioxolane moiety makes it a valuable intermediate for the creation of diverse organic compounds. Specifically, in the synthesis of pharmaceuticals and agrochemicals, $name$ serves as a key component for introducing functional groups and controlling reactivity. Its presence enables the formation of complex molecules with specific biological activities, making it a valuable tool for medicinal and agricultural chemistry research. Through strategic manipulation of its chemical properties, $name$ offers a platform for the development of novel compounds with potential applications in various industries.
Literature
FEATURED PRODUCTS