logo
Home  > 2(1H)-Pyridinone, 3-[(2S,4S,5R)-5,6-dichloro-2,4-dimethyl-1-oxohexyl]-4-hydroxy-5,6-dimethoxy-

AA24325

119509-24-9 | 2(1H)-Pyridinone, 3-[(2S,4S,5R)-5,6-dichloro-2,4-dimethyl-1-oxohexyl]-4-hydroxy-5,6-dimethoxy-

Packsize Purity Availability Price Discounted Price    Quantity
1mg 95% in stock $335.00 $235.00 -   +
5mg 95% in stock $680.00 $476.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA24325
Chemical Name: 2(1H)-Pyridinone, 3-[(2S,4S,5R)-5,6-dichloro-2,4-dimethyl-1-oxohexyl]-4-hydroxy-5,6-dimethoxy-
CAS Number: 119509-24-9
Molecular Formula: C15H21Cl2NO5
Molecular Weight: 366.2369
MDL Number: MFCD01664873
SMILES: C[C@H](C(=O)c1c(O)c(OC)c([nH]c1=O)OC)C[C@@H]([C@H](CCl)Cl)C

 

Upstream Synthesis Route 
  • The chemical compound Atpenin A 5 plays a crucial role in chemical synthesis as a potent inhibitor of mitochondrial complex II. Its unique structure and mechanism of action make it a valuable tool for researchers in the field of organic chemistry. By selectively targeting mitochondrial complex II, Atpenin A 5 can modulate cellular functions and pathways, offering insights into various biological processes. Through its use in chemical synthesis, Atpenin A 5 enables the development of new compounds and pharmaceutical agents with potential applications in drug discovery and biotechnology. Its ability to interact with specific targets makes it a valuable asset in the study of complex biological systems and pathways.
FEATURED PRODUCTS