AX64624
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $35.00 | $24.00 | - + | |
5mg | 95% | in stock | $73.00 | $51.00 | - + | |
10mg | 95% | in stock | $108.00 | $75.00 | - + | |
25mg | 95% | in stock | $180.00 | $126.00 | - + | |
50mg | 95% | in stock | $273.00 | $191.00 | - + | |
250mg | 95% | in stock | $869.00 | $608.00 | - + | |
1g | 95% | in stock | $1,910.00 | $1,337.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX64624 |
Chemical Name: | GDC-0575 |
CAS Number: | 1196541-47-5 |
Molecular Formula: | C16H20BrN5O |
Molecular Weight: | 378.2669 |
MDL Number: | MFCD29048675 |
SMILES: | N[C@@H]1CCCN(C1)c1c(Br)cnc2c1c(c[nH]2)NC(=O)C1CC1 |
The chemical compound (R)-N-(4-(3-aminopiperidin-1-yl)-5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)cyclopropanecarboxamide, hereinafter referred to as $name$, serves as a versatile building block in chemical synthesis processes. $name$ plays a crucial role in the development of novel pharmaceuticals, agrochemicals, and materials due to its unique structural properties. It can be used as a key intermediate in the synthesis of biologically active compounds by incorporating its distinct cyclopropane and pyrrolopyridine moieties. In medicinal chemistry, $name$ can be utilized to introduce specific functionalities into drug candidates, enhancing their potency, selectivity, and pharmacokinetic properties. Its presence can modulate interactions with biological targets, leading to the creation of potential therapeutic agents for various diseases. Moreover, $name$ can be employed in the synthesis of complex organic molecules through strategic transformations, such as cross-coupling reactions, cyclizations, and functional group manipulations. Its cyclopropane ring offers opportunities for stereochemical control and molecular diversity, making it a valuable tool in organic synthesis. Overall, the application of (R)-N-(4-(3-aminopiperidin-1-yl)-5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)cyclopropanecarboxamide in chemical synthesis represents a promising avenue for the design and production of innovative compounds with diverse functionalities and potential applications.